CAS 28374-86-9
:3-chlorohexa-1,5-diene
Description:
3-Chlorohexa-1,5-diene is an organic compound characterized by its structure, which includes a six-carbon chain with two double bonds and a chlorine substituent. The presence of the chlorine atom at the third carbon position contributes to its reactivity and potential applications in organic synthesis. The compound features a conjugated diene system due to the arrangement of double bonds between the first and second, as well as the fifth and sixth carbons, which can enhance its stability and reactivity in various chemical reactions, such as Diels-Alder reactions or polymerization processes. 3-Chlorohexa-1,5-diene is typically a colorless to pale yellow liquid, and its physical properties, such as boiling point and solubility, can vary based on environmental conditions. As with many chlorinated compounds, it may exhibit toxicity and should be handled with care in a laboratory setting. Its applications may extend to the fields of pharmaceuticals, agrochemicals, and materials science, where it can serve as an intermediate or building block for more complex molecules.
Formula:C6H9Cl
InChI:InChI=1/C6H9Cl/c1-3-5-6(7)4-2/h3-4,6H,1-2,5H2
SMILES:C=CCC(C=C)Cl
Synonyms:- 1,5-Hexadiene, 3-Chloro-
- 3-Chloro-1,5-hexadiene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

