CAS 28374-93-8
:3,5-Dihydroxycinnamic acid
Description:
3,5-Dihydroxycinnamic acid, with the CAS number 28374-93-8, is an organic compound that belongs to the class of phenolic acids. It is characterized by the presence of two hydroxyl (-OH) groups located at the 3 and 5 positions of the cinnamic acid structure, which consists of a trans-styryl moiety. This compound typically appears as a white to pale yellow solid and is soluble in polar solvents such as water and alcohols. 3,5-Dihydroxycinnamic acid exhibits antioxidant properties, making it of interest in various fields, including food science and pharmaceuticals. Its structure allows it to participate in various biochemical reactions, and it may play a role in plant defense mechanisms. Additionally, it has been studied for potential health benefits, including anti-inflammatory and antimicrobial effects. The compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in its applications and storage.
Formula:C9H8O4
InChI:InChI=1S/C9H8O4/c10-7-3-6(1-2-9(12)13)4-8(11)5-7/h1-5,10-11H,(H,12,13)
InChI key:InChIKey=MFFCZSWTQMCKFP-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=CC(O)=CC(O)=C1
Synonyms:- (2E)-3-(3,5-Dihydroxyphenyl)acrylic acid
- 2-Propenoic acid, 3-(3,5-dihydroxyphenyl)-
- 2-propenoic acid, 3-(3,5-dihydroxyphenyl)-, (2E)-
- 3,5-Dihydroxycinnamic acid
- 3-(3,5-Dihydroxyphenyl)-2-propenoic acid
- Cinnamic acid, 3,5-dihydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3,5-Dihydroxycinnamic acid
CAS:3,5-Dihydroxycinnamic acid is a metabolite of the amino acid tyrosine and an intermediate in the biosynthesis of phenylalanine. It has been shown to have anti-inflammatory properties that may be due to its ability to inhibit prostaglandin synthesis. 3,5-Dihydroxycinnamic acid has also been identified as a carcinogen and is associated with an increased risk of cancer in women. 3,5-Dihydroxycinnamic acid is found in urine samples at concentrations between 2 and 10 µmol/L.
Formula:C9H8O4Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:180.16 g/molRef: 3D-FD67031
Discontinued product
