CAS 28383-41-7

Flavanone, 3,3′,5,7-tetrahydroxy-4′-methoxy-, 7-[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside]

Description:

Flavanone, 3,3′,5,7-tetrahydroxy-4′-methoxy-, 7-[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside] is a glycosylated flavanone, a type of flavonoid characterized by its polyphenolic structure. This compound features multiple hydroxyl groups, which contribute to its antioxidant properties, and a methoxy group that can influence its solubility and reactivity. The presence of the glycosidic bond, linking a sugar moiety (in this case, a deoxy-mannopyranosyl and a glucopyranosyl unit) to the flavanone core, enhances its biological activity and potential health benefits. Flavonoids are known for their roles in plant pigmentation and UV protection, and they exhibit various pharmacological effects, including anti-inflammatory, antimicrobial, and anticancer activities. The specific structural features of this compound may also affect its interaction with biological systems, influencing its bioavailability and efficacy. Overall, this flavanone derivative represents a complex molecule with potential applications in nutraceuticals and pharmaceuticals, warranting further investigation into its biological properties and mechanisms of action.

Formula: C₂₈H₃₄O₁₆

InChI: InChI=1S/C28H34O16/c1-9-18(32)21(35)24(38)27(40-9)44-26-22(36)19(33)16(8-29)43-28(26)41-11-6-13(31)17-15(7-11)42-25(23(37)20(17)34)10-3-4-14(39-2)12(30)5-10/h3-7,9,16,18-19,21-33,35-38H,8H2,1-2H3

InChI key: InChIKey=OWOPLXKZQIHNFD-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC(C1O)C3=CC(O)=C(OC)C=C3)=CC(OC4C(OC5C(O)C(O)C(O)C(C)O5)C(O)C(O)C(CO)O4)=CC2O

Synonyms:

• Flavanone, 3,3′,5,7-tetrahydroxy-4′-methoxy-, 7-[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside]

7-Neohesperidosides

CAS: 28383-41-7

7-Neohesperidosides is a natral product from Citrus aurantium L.

Formula: C₂₈H₃₄O₁₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 626.564

Ref: TM-TN3239

7-Neohesperidosides

CAS: 28383-41-7

7-Neohesperidosides is a type of flavonoid glycoside, often sourced from citrus fruits such as sweet oranges and grapefruits. This compound is formed by the attachment of a sugar molecule to the flavonoid hesperetin, which alters its physical and chemical properties. The mode of action primarily involves its interaction with taste receptors, where it modifies sweetness perception. As a sweetness-enhancing compound, it offers potential applications in flavor modification and development processes.

Formula: C₂₈H₃₄O₁₆

Purity: Min. 95%

Molecular weight: 626.60 g/mol

Ref: 3D-DBA38341