CymitQuimica logo

CAS 28391-17-5

:

3-Butenoic acid, homopolymer

Description:
3-Butenoic acid, homopolymer, also known as poly(3-butenoic acid), is a synthetic polymer derived from the polymerization of 3-butenoic acid monomers. This polymer exhibits characteristics typical of polyacrylic acids, including good solubility in water and organic solvents, depending on the degree of polymerization and molecular weight. It is generally a colorless to light yellow solid or viscous liquid, with a relatively low glass transition temperature, which allows it to remain flexible at room temperature. The polymer is known for its potential applications in various fields, including adhesives, coatings, and as a dispersant due to its carboxylic acid functional groups, which can interact with various substrates. Additionally, the presence of these functional groups imparts properties such as pH sensitivity and the ability to form hydrogen bonds, enhancing its utility in formulations requiring thickening or stabilizing agents. Overall, 3-butenoic acid, homopolymer, is valued for its versatility and functional properties in industrial applications.
Formula:(C4H6O2)x
InChI:InChI=1S/C4H6O2/c1-2-3-4(5)6/h2H,1,3H2,(H,5,6)
InChI key:InChIKey=PVEOYINWKBTPIZ-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=C
Synonyms:
  • 3-Butenoic acid, homopolymer
  • Poly(vinylacetic acid)
  • 3-Butenoic acid, polymers
  • Vinylacetic acid polymer
  • Poly(3-butenoic acid)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.