CAS 28392-96-3
:2-hydroxy-3-(3-hydroxy-1-phenylbutyl)-4H-chromen-4-one
Description:
2-Hydroxy-3-(3-hydroxy-1-phenylbutyl)-4H-chromen-4-one, also known by its CAS number 28392-96-3, is a chemical compound belonging to the flavonoid class, specifically a type of chromone. This compound features a chromone backbone, which is characterized by a benzopyran structure, and is substituted with hydroxyl groups and a phenylbutyl side chain. The presence of hydroxyl groups contributes to its potential antioxidant properties, making it of interest in various biological and pharmaceutical applications. The compound's structure suggests it may exhibit various biological activities, including anti-inflammatory and anticancer effects, although specific biological data would depend on empirical studies. Its solubility and stability can vary based on the pH and solvent used, which is typical for flavonoids. Overall, 2-hydroxy-3-(3-hydroxy-1-phenylbutyl)-4H-chromen-4-one represents a complex organic molecule with potential utility in medicinal chemistry and natural product research.
Formula:C19H18O4
InChI:InChI=1/C19H18O4/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22/h2-10,12,15,20,22H,11H2,1H3
SMILES:CC(CC(c1ccccc1)c1c(=O)c2ccccc2oc1O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Warfarin Alcohol (Mixture of Diastereomers)
CAS:Controlled ProductFormula:C19H18O4Color and Shape:NeatMolecular weight:310.344Warfarin alcohol, mixture of diastereomers
CAS:Warfarin is a clinically used drug that is an anticoagulant and has been shown to have anticancer activity. Warfarin has been shown to inhibit the synthesis of unsaturated ketones by carbonyl reduction and asymmetric synthesis. It also inhibits the growth of cancer cells in animals and human liver cells. Warfarin reduces the production of coagulation factors II, VII, IX, and X by inhibiting protein synthesis in the liver. The anticoagulant effect of warfarin is due to inhibition of the synthesis of vitamin K-dependent clotting factors II, VII, IX, and X. Warfarin also binds to a cytosolic protein called matrix metalloproteinase-9 (MMP-9) which inhibits its proteolytic activity.Formula:C19H18O4Purity:Min. 95%Molecular weight:310.3 g/mol
