CAS 28393-02-4
:10,12-Docosadiyndioic acid
Description:
10,12-Docosadiyndioic acid, also known by its systematic name, is a dicarboxylic acid characterized by a long carbon chain with two terminal carboxylic acid groups and two triple bonds located at the 10th and 12th carbon positions. This compound belongs to the family of polyunsaturated fatty acids and is notable for its unique structural features, which contribute to its chemical reactivity and potential applications. It is typically a solid at room temperature and exhibits properties such as high melting points due to its long carbon chain. The presence of multiple triple bonds imparts significant unsaturation, influencing its physical and chemical behavior, including its solubility in organic solvents. 10,12-Docosadiyndioic acid may also participate in various chemical reactions, such as polymerization or esterification, making it of interest in materials science and biochemistry. Its CAS number, 28393-02-4, is a unique identifier that facilitates its recognition in chemical databases and literature.
Formula:C22H34O4
InChI:InChI=1/C22H34O4/c23-21(24)19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22(25)26/h5-20H2,(H,23,24)(H,25,26)
SMILES:C(#CCCCCCCCCC(=O)O)C#CCCCCCCCCC(=O)O
Synonyms:- 10,12-Docosadiynedioic acid
- Docosa-10,12-Diynedioic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
10,12-Docosadiynedioic acid, 95%
CAS:Polymerizable diacid (10,12-docosadiynedioic acid) was used as obtained from GFS Chemicals. Synthesis of dimesogenic liquid crystals with both cholesterol and azobenzene groups is by the esterification of 10,12-docosadiynedioic acid. . This Thermo Scientific Chemicals brand product was originally paFormula:C22H34O4Purity:95%Color and Shape:Very pale blue to blue to grey, Crystals or powder or crystalline powderMolecular weight:362.51Docosa-10,12-diynedioic acid
CAS:Formula:C22H34O4Purity:95%Color and Shape:SolidMolecular weight:362.5030


