CAS 28393-06-8

Heptadecadiynoic acid

Description:

Heptadecadiynoic acid, also known as 1-heptadecadiynoic acid, is a long-chain fatty acid characterized by its unique structure featuring two triple bonds (alkyne functional groups) within a 17-carbon chain. This compound is classified as a polyunsaturated fatty acid, which contributes to its distinct physical and chemical properties. Heptadecadiynoic acid is typically a solid at room temperature and is insoluble in water due to its hydrophobic nature, but it can dissolve in organic solvents. Its molecular structure allows for potential applications in various fields, including materials science and biochemistry, particularly in the synthesis of polymers and as a precursor for bioactive compounds. The presence of multiple triple bonds can also influence its reactivity, making it a subject of interest in organic synthesis and chemical research. Additionally, it may exhibit unique biological activities, although specific studies on its biological effects are limited. Overall, heptadecadiynoic acid represents a fascinating compound within the realm of fatty acids and organic chemistry.

Formula: C₁₇H₂₆O₂

InChI: InChI=1/C17H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2-4,9-16H2,1H3,(H,18,19)

SMILES: CCCCC#CC#CCCCCCCCCC(=O)O

Synonyms:

• 10,12-Heptadecadiynoic acid

10,12-Heptadecadiynoic Acid

CAS: 28393-06-8

Formula: C₁₇H₂₆O₂

Purity: >97.0%(T)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 262.39

Ref: 3B-H0775

10,12-HEptadecadiynoic acid

CAS: 28393-06-8

Formula: C₁₇H₂₆O₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 262.3871

Ref: IN-DA003DTW

Heptadeca-10,12-diynoic acid

CAS: 28393-06-8

Purity: ≥97%(T)

Molecular weight: 262.3930054

Ref: 10-F759989

10,12-Heptadecadiynoic Acid

CAS: 28393-06-8

10,12-Heptadecadiynoic Acid is a chiral compound that can be used in the treatment of cancer. It is an amphiphilic molecule that has been shown to interact with hydrophobic surfaces such as metal and polymer surfaces. 10,12-Heptadecadiynoic Acid also interacts with biomolecules such as DNA and RNA. This interaction leads to gelation or solvation depending on the solvent used. Irradiation of 10,12-Heptadecadiynoic Acid causes it to form a long-chain polymerized molecule.

Purity: Min. 95%

Ref: 3D-FH61936