CAS 28399-17-9
:(2R,4aR,8aR)-1,2,3,4,4a,5,6,8a-Octahydro-4a,8-dimethyl-α-methylene-2-naphthaleneacetic acid
Description:
The chemical substance known as "(2R,4aR,8aR)-1,2,3,4,4a,5,6,8a-Octahydro-4a,8-dimethyl-α-methylene-2-naphthaleneacetic acid," with the CAS number 28399-17-9, is a bicyclic compound characterized by its complex polycyclic structure. This compound features a naphthalene ring system fused with a cyclohexane framework, contributing to its unique three-dimensional conformation. The presence of multiple chiral centers indicates that it can exist in various stereoisomeric forms, which may influence its biological activity and chemical reactivity. The α-methylene group suggests potential reactivity in various organic transformations, while the carboxylic acid functional group provides acidic properties, allowing for interactions with bases and participation in esterification or amidation reactions. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry, although detailed studies on its biological effects and applications would be necessary to fully understand its potential uses. Overall, its structural complexity and functional groups position it as a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C15H22O2
InChI:InChI=1S/C15H22O2/c1-10-5-4-7-15(3)8-6-12(9-13(10)15)11(2)14(16)17/h5,12-13H,2,4,6-9H2,1,3H3,(H,16,17)/t12-,13+,15-/m1/s1
InChI key:InChIKey=UTXMCYDEIZPGME-VNHYZAJKSA-N
SMILES:C[C@]12[C@@](C[C@H](C(C(O)=O)=C)CC1)(C(C)=CCC2)[H]
Synonyms:- (2R,4aR,8aR)-1,2,3,4,4a,5,6,8a-Octahydro-4a,8-dimethyl-α-methylene-2-naphthaleneacetic acid
- 2-Naphthaleneacetic acid, 1,2,3,4,4a,5,6,8a-octahydro-4a,8-dimethyl-α-methylene-, (2R,4aR,8aR)-
- 2-Naphthaleneacetic acid, 1,2,3,4,4a,5,6,8a-octahydro-4a,8-dimethyl-α-methylene-, [2R-(2α,4aα,8aβ)]-
- 2-naphthaleneacetic acid, 1,2,3,4,4a,5,6,8a-octahydro-4a,8-dimethyl-alpha-methylene-, (2R,4aR,8aR)-
- Eudesma-3,11(13)-dien-12-oic acid
- α-Costic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
