
CAS 28399-50-0
:(3R)-3,4-Dihydro-3,6,8-trihydroxy-3-methylbenz[a]anthracene-1,7,12(2H)-trione
Description:
(3R)-3,4-Dihydro-3,6,8-trihydroxy-3-methylbenz[a]anthracene-1,7,12(2H)-trione, with CAS number 28399-50-0, is a polycyclic aromatic compound characterized by its complex structure, which includes multiple hydroxyl groups and a trione functional group. This compound is derived from the benz[a]anthracene framework, which is known for its fused aromatic rings. The presence of hydroxyl groups contributes to its potential reactivity and solubility in polar solvents, while the trione structure indicates the presence of three carbonyl groups, which can participate in various chemical reactions, including oxidation and reduction processes. The stereochemistry, indicated by the (3R) designation, suggests specific spatial arrangements that can influence the compound's biological activity and interactions with other molecules. Such compounds are often studied for their potential applications in fields like medicinal chemistry, environmental science, and materials science, particularly due to their unique properties and reactivity patterns.
Formula:C19H14O6
InChI:InChI=1S/C19H14O6/c1-19(25)6-8-5-11(21)15-16(13(8)12(22)7-19)17(23)9-3-2-4-10(20)14(9)18(15)24/h2-5,20-21,25H,6-7H2,1H3/t19-/m1/s1
InChI key:InChIKey=JJOLHRYZQSDLSA-LJQANCHMSA-N
SMILES:O=C1C=2C3=C(C(=O)C=4C(C3=O)=CC=CC4O)C(O)=CC2C[C@@](C)(O)C1
Synonyms:- Benz[a]anthracene-1,7,12(2H)-trione, 3,4-dihydro-3,6,8-trihydroxy-3-methyl-, (3R)-
- (-)-Rabelomycin
- Benz[a]anthracene-1,7,12(2H)-trione, 3,4-dihydro-3,6,8-trihydroxy-3-methyl-, (R)-
- (3R)-3,4-Dihydro-3,6,8-trihydroxy-3-methylbenz[a]anthracene-1,7,12(2H)-trione
- Rabelomycin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Rabelomycin
CAS:Rabelomycin is an angucycline group antibiotic.Formula:C19H14O6Color and Shape:SolidMolecular weight:338.31
