CymitQuimica logo

CAS 28399-82-8

:

ethyl (1-methylpiperidin-4-ylidene)acetate

Description:
Ethyl (1-methylpiperidin-4-ylidene)acetate, identified by its CAS number 28399-82-8, is an organic compound characterized by its ester functional group, which is formed from the reaction of acetic acid and an amine. This compound features a piperidine ring, specifically a 1-methylpiperidine, which contributes to its unique structural and chemical properties. The presence of the ethyl acetate moiety suggests that it may exhibit moderate polarity, making it soluble in various organic solvents. The piperidine ring can influence the compound's reactivity and potential biological activity, as piperidine derivatives are often associated with pharmacological properties. Additionally, the compound may possess a distinct odor, typical of many esters, which can be fruity or sweet. Its applications could range from use in organic synthesis to potential roles in medicinal chemistry, although specific applications would depend on further research into its properties and behavior in various chemical environments. Safety data should be consulted for handling and usage guidelines.
Formula:C10H17NO2
InChI:InChI=1/C10H17NO2/c1-3-13-10(12)8-9-4-6-11(2)7-5-9/h8H,3-7H2,1-2H3
SMILES:CCOC(=O)C=C1CCN(C)CC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.