CAS 2840-04-2: 5-Amino-2-methylbenzoic acid
Description:5-Amino-2-methylbenzoic acid, also known as 5-amino-o-toluic acid, is an aromatic amino acid derivative characterized by the presence of both an amino group (-NH2) and a carboxylic acid group (-COOH) attached to a methyl-substituted benzene ring. Its molecular formula is C8H9N1O2, indicating it contains eight carbon atoms, nine hydrogen atoms, one nitrogen atom, and two oxygen atoms. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its functional groups. The amino group can participate in hydrogen bonding, enhancing its solubility. 5-Amino-2-methylbenzoic acid is often used in organic synthesis and as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. Its properties, such as melting point and boiling point, can vary based on purity and environmental conditions. Safety data should be consulted for handling, as it may pose health risks if ingested or inhaled.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,9H2,1H3,(H,10,11)
InChI key:InChIKey=FSXVZWAWYKMFMX-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC(N)=CC=C1C
- Synonyms:
- 2-Methyl-5-Aminobenzoic Acid
- 3-Amino-6-methylbenzoic acid
- 5-Amino-2-Methylbenzoic Acid
- Benzoic acid, 5-amino-2-methyl-
- o-Toluic acid, 5-amino-
