CAS 2840-28-0
:3-Amino-4-chlorobenzoic acid
Description:
3-Amino-4-chlorobenzoic acid, with the CAS number 2840-28-0, is an aromatic amino acid derivative characterized by the presence of both an amino group (-NH2) and a carboxylic acid group (-COOH) on a chlorinated benzene ring. Specifically, the amino group is located at the meta position relative to the carboxylic acid, while a chlorine atom is situated at the para position. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. It exhibits acidic properties due to the carboxylic acid group, allowing it to participate in various chemical reactions, including amide formation and electrophilic substitution. 3-Amino-4-chlorobenzoic acid is often utilized in organic synthesis, pharmaceuticals, and as an intermediate in the production of dyes and agrochemicals. Its biological activity may also be of interest in medicinal chemistry, particularly in the development of compounds with potential therapeutic applications.
Formula:C7H6ClNO2
InChI:InChI=1S/C7H6ClNO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,9H2,(H,10,11)
InChI key:InChIKey=DMGFVJVLVZOSOE-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(N)=C(Cl)C=C1
Synonyms:- 3-Amino-4-Chlorobenzoate
- 4-Chloro-3-aminobenzoic acid
- 4-Chloro-5-aminobenzoic acid
- Benzoic acid, 3-amino-4-chloro-
- NSC 211572
- 3-Amino-4-chlorobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Amino-4-chlorobenzoic Acid
CAS:Formula:C7H6ClNO2Purity:>98.0%(T)(HPLC)Color and Shape:White to Green to Brown powder to crystalMolecular weight:171.583-Amino-4-chlorobenzoic acid
CAS:Formula:C7H6ClNO2Purity:97%Color and Shape:SolidMolecular weight:171.58103-Amino-4-chlorobenzoic acid
CAS:3-Amino-4-chlorobenzoic acid is a diacid that has been shown to have strong steric interactions with manumycin and fibrinogen, which are proteins found in the human body. 3-Amino-4-chlorobenzoic acid has a carboxylate group at one end of the molecule, which can coordinate to metal ions such as chloride. The other end of the molecule contains a hydrogen atom that can form hydrogen bonds with other molecules. 3-Amino-4-chlorobenzoic acid can be synthesized by reacting 2 moles of chloroacetyl chloride with an amino acid.Formula:C7H6ClNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:171.58 g/mol3-Amino-4-chlorobenzoic acid
CAS:Formula:C7H6ClNO2Purity:97%Color and Shape:SolidMolecular weight:171.583-Amino-4-chlorobenzoic Acid
CAS:Controlled ProductApplications 3-Amino-4-chlorobenzoic acid (cas# 2840-28-0) is a useful research chemical.
Formula:C7H6ClNO2Color and Shape:NeatMolecular weight:171.58






