CymitQuimica logo

CAS 2840-61-1

:

3-methyl-5-oxo-5-phenylpentanoic acid

Description:
3-Methyl-5-oxo-5-phenylpentanoic acid, with the CAS number 2840-61-1, is an organic compound characterized by its carboxylic acid functional group and a ketone group. This compound features a five-carbon backbone with a methyl group and a phenyl group attached, contributing to its unique structural properties. It typically appears as a solid or viscous liquid, depending on the temperature and purity. The presence of both the ketone and carboxylic acid functional groups allows for a range of chemical reactivity, including potential participation in condensation reactions and esterification. Its molecular structure suggests it may exhibit moderate solubility in polar solvents, while being less soluble in non-polar solvents. Additionally, the compound may show biological activity, making it of interest in pharmaceutical and synthetic organic chemistry. As with many organic acids, it may exhibit acidic properties, influencing its behavior in various chemical environments. Safety data should be consulted for handling and storage, as it may pose health risks if not managed properly.
Formula:C12H14O3
InChI:InChI=1/C12H14O3/c1-9(8-12(14)15)7-11(13)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,14,15)
InChI key:DGKMKGNXHZXIKE-UHFFFAOYSA-N
SMILES:CC(CC(=O)c1ccccc1)CC(=O)O
Synonyms:
  • Benzenepentanoic acid, beta-methyl-delta-oxo-
  • 3-Methyl-5-Oxo-5-Phenylvaleric Acid
  • 3-Methyl-5-oxo-5-phenylpentanoic acid
Found 3 products.