CAS 284040-71-7

2-[(5-bromopyridin-3-yl)oxy]ethanol

Description:

2-[(5-bromopyridin-3-yl)oxy]ethanol is an organic compound characterized by its structure, which features a pyridine ring substituted with a bromine atom and an ether functional group linked to an ethanol moiety. This compound typically exhibits a polar nature due to the presence of the hydroxyl (-OH) group, which enhances its solubility in polar solvents such as water. The bromine substituent on the pyridine ring can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may display biological activity, as many pyridine derivatives are known for their pharmacological properties. Its molecular structure suggests that it could participate in hydrogen bonding, further affecting its physical properties such as boiling point and melting point. Overall, 2-[(5-bromopyridin-3-yl)oxy]ethanol is a versatile compound with applications in medicinal chemistry and material science, although specific applications would depend on further research and characterization.

Formula: C₇H₈BrNO₂

InChI: InChI=1/C7H8BrNO2/c8-6-3-7(5-9-4-6)11-2-1-10/h3-5,10H,1-2H2

SMILES: C(COc1cc(cnc1)Br)O

2-((5-Bromopyridin-3-yl)oxy)ethanol

CAS: 284040-71-7

Formula: C₇H₈BrNO₂

Molecular weight: 218.0479

Ref: IN-DA007KM4

2-[(5-Bromopyridin-3-yl)oxy]ethan-1-ol

CAS: 284040-71-7

Versatile small molecule scaffold

Formula: C₇H₈BrNO₂

Purity: Min. 95%

Molecular weight: 218.05 g/mol

Ref: 3D-JLA04071