CAS 2844-05-5

2-Bromo-6-(trifluoromethyl)phenol

Description:

2-Bromo-6-(trifluoromethyl)phenol is an organic compound characterized by the presence of a bromine atom and a trifluoromethyl group attached to a phenolic structure. Its molecular formula is C7H4BrF3O, indicating that it contains seven carbon atoms, four hydrogen atoms, one bromine atom, three fluorine atoms, and one oxygen atom. This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique reactivity and functional groups. The bromine atom enhances its electrophilic character, while the trifluoromethyl group can influence its lipophilicity and biological activity. 2-Bromo-6-(trifluoromethyl)phenol is also notable for its potential use in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Proper handling and disposal methods are essential when working with this substance in laboratory or industrial settings.

Formula: C₇H₄BrF₃O

InChI: InChI=1S/C7H4BrF3O/c8-5-3-1-2-4(6(5)12)7(9,10)11/h1-3,12H

SMILES: c1cc(c(c(c1)Br)O)C(F)(F)F

2-Bromo-6-(trifluoromethyl)phenol

CAS: 2844-05-5

Formula: C₇H₄BrF₃O

Purity: 95%

Color and Shape: Liquid

Molecular weight: 241.0053

Ref: IN-DA0039TP

2-Bromo-6-(trifluoromethyl)phenol

CAS: 2844-05-5

2-Bromo-6-(trifluoromethyl)phenol

Formula: C₇H₄BrF₃O

Purity: 97%

Color and Shape: yellow liquid

Molecular weight: 241.01g/mol

Ref: 54-PC500167

2-Bromo-6-(trifluoromethyl)phenol

CAS: 2844-05-5

Formula: C₇H₄BrF₃O

Purity: 96%

Molecular weight: 241.007

Ref: 10-F223829