
CAS 28441-98-7
:Agathisflavone
Description:
Agathisflavone is a naturally occurring flavonoid compound, primarily derived from various plant sources, particularly those in the Agathis genus. It is characterized by its unique chemical structure, which includes multiple aromatic rings and hydroxyl groups, contributing to its potential biological activities. Agathisflavone has garnered interest in the field of pharmacology due to its reported antioxidant, anti-inflammatory, and anticancer properties. The compound exhibits a yellowish color and is soluble in organic solvents, which is typical for flavonoids. Its molecular formula and specific structural features allow it to interact with various biological targets, making it a subject of research in natural product chemistry and medicinal applications. Additionally, studies have indicated that Agathisflavone may play a role in modulating cellular pathways, although further research is necessary to fully elucidate its mechanisms of action and therapeutic potential. As with many flavonoids, its safety profile and efficacy in humans require thorough investigation before any clinical applications can be established.
Formula:C30H18O10
InChI:InChI=1S/C30H18O10/c31-15-5-1-13(2-6-15)22-11-20(36)26-24(39-22)12-21(37)27(29(26)38)28-18(34)9-17(33)25-19(35)10-23(40-30(25)28)14-3-7-16(32)8-4-14/h1-12,31-34,37-38H
InChI key:InChIKey=BACLASYRJRZXMY-UHFFFAOYSA-N
SMILES:OC=1C(=C2C(C(=O)C=C(O2)C3=CC=C(O)C=C3)=C(O)C1)C=4C(O)=C5C(=CC4O)OC(=CC5=O)C6=CC=C(O)C=C6
Synonyms:- 6,8′′-Biflavone, 4′,4′′′,5,5′′,7,7′′-hexahydroxy-
- Agathisflavone
- [6,8′-Bi-4H-1-benzopyran]-4,4′-dione, 5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)-
- Agathisflavon
- 5,5′,7,7′-Tetrahydroxy-2,2′-bis(4-hydroxyphenyl)[6,8′-bi-4H-1-benzopyran]-4,4′-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Agathisflavone
CAS:<p>Agathisflavone is a NS2B-NS3 proteases inhibitor of the Dengue virus serotypes 2 and 3.</p>Formula:C30H18O10Color and Shape:SolidMolecular weight:538.46
