CAS 28443-52-9

N-(4-chloro-3-hydroxyphenyl)acetamide

Description:

N-(4-chloro-3-hydroxyphenyl)acetamide, with the CAS number 28443-52-9, is an organic compound characterized by its acetamide functional group attached to a substituted phenyl ring. The presence of a chlorine atom at the para position and a hydroxyl group at the meta position on the phenyl ring contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its polar nature due to the hydroxyl group. It may exhibit biological activity, making it of interest in pharmaceutical research. The compound's structure suggests potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, its stability and reactivity can be influenced by the substituents on the aromatic ring, affecting its behavior in various chemical reactions. Overall, N-(4-chloro-3-hydroxyphenyl)acetamide serves as a valuable compound in both synthetic chemistry and medicinal chemistry contexts.

Formula: C₈H₈ClNO₂

InChI: InChI=1/C8H8ClNO2/c1-5(11)10-6-2-3-7(9)8(12)4-6/h2-4,12H,1H3,(H,10,11)

SMILES: CC(=Nc1ccc(c(c1)O)Cl)O

N-(4-Chloro-3-hydroxyphenyl)acetamide

CAS: 28443-52-9

Formula: C₈H₈ClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 185.6076

Ref: IN-DA003MBK

4'-Chloro-3'-hydroxyacetanilide

CAS: 28443-52-9

4'-Chloro-3'-hydroxyacetanilide

Purity: 98%

Molecular weight: 185.61g/mol

Ref: 54-OR59372

N-(4-Chloro-3-hydroxyphenyl)acetamide

CAS: 28443-52-9

Formula: C₈H₈ClNO₂

Purity: 98%

Molecular weight: 185.61

Ref: 10-F209952