CAS 284461-74-1
:4-[4-[[[[4-Chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]phenoxy]-2-pyridinecarboxamide
Description:
4-[4-[[[[4-Chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]phenoxy]-2-pyridinecarboxamide, with CAS number 284461-74-1, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as amides and phenoxy groups. This compound features a chloro-substituted trifluoromethyl phenyl moiety, contributing to its potential biological activity and lipophilicity. The presence of a pyridine ring enhances its chemical reactivity and solubility in various solvents. Typically, compounds of this nature are investigated for their pharmacological properties, including potential applications in medicinal chemistry, particularly in the development of therapeutic agents. The specific arrangement of atoms and functional groups suggests that it may interact with biological targets, making it of interest in drug discovery. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are crucial for understanding its behavior in biological systems.
Formula:C20H14ClF3N4O3
InChI:InChI=1S/C20H14ClF3N4O3/c21-16-6-3-12(9-15(16)20(22,23)24)28-19(30)27-11-1-4-13(5-2-11)31-14-7-8-26-17(10-14)18(25)29/h1-10H,(H2,25,29)(H2,27,28,30)
InChI key:InChIKey=UAEWBZYTKIMYRQ-UHFFFAOYSA-N
SMILES:O(C=1C=C(C(N)=O)N=CC1)C2=CC=C(NC(NC3=CC(C(F)(F)F)=C(Cl)C=C3)=O)C=C2
Synonyms:- 4-[4-[[[[4-Chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]phenoxy]-2-pyridinecarboxamide
- BAY 43-9007
- 2-Pyridinecarboxamide, 4-[4-[[[[4-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]phenoxy]-
- N-Desmethylsorafenib
- N-[4-Chloro-3-(trifluoromethyl)phenyl]-N′-[4-(2-carbamoyl-4-pyridyloxy)phenyl]urea
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(4-(3-(4-Chloro-3-(trifluoromethyl)phenyl)ureido)phenoxy)picolinamide
CAS:4-(4-(3-(4-Chloro-3-(trifluoromethyl)phenyl)ureido)phenoxy)picolinamidePurity:98%Molecular weight:450.8g/molN-Desmethyl Sorafenib
CAS:Controlled Product<p>Applications N-Desmethyl Sorafenib is a metabolite of Sorafenib (S676850) and has anti-proliferative activity in human breast cancer cells.<br>References Cui, P.H., et al.: Biochem. Pharmacol., 86, 419 (2013); Ghassabian, S., et al.: Biochem. Pharmacol., 84, 215 (2012)<br></p>Formula:C21H15ClF3N3O3Color and Shape:Light RedMolecular weight:449.81N-Desmethyl sorafenib
CAS:N-desmethyl sorafenib is an analytical standard for the HPLC assay of sorafenib. It is a metabolite of sorafenib, which is a drug used in the treatment of cancer. It has been shown to inhibit protein synthesis and cell growth in vitro and in vivo. N-desmethyl sorafenib has been shown to inhibit the activity of methionine adenosyltransferase, leading to inhibition of DNA synthesis. The chemical properties are similar to those of other drugs that have been approved by the US Food and Drug Administration.Formula:C20H14ClF3N4O3Purity:Min. 95%Molecular weight:450.80 g/mol





