CAS 284464-83-1
:N-[[(1,1-Dimethylethyl)amino]carbonyl]-2-[(4-methylphenyl)amino]-5-nitrobenzenesulfonamide
Description:
N-[[(1,1-Dimethylethyl)amino]carbonyl]-2-[(4-methylphenyl)amino]-5-nitrobenzenesulfonamide, with CAS number 284464-83-1, is a sulfonamide compound characterized by its complex structure, which includes a sulfonamide group, a nitro group, and multiple aromatic rings. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its functional groups. The presence of the nitro group may impart specific reactivity and influence its pharmacological properties. Additionally, the bulky tert-butyl group can affect the compound's steric hindrance and overall molecular interactions. Such compounds are often investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The sulfonamide moiety is known for its antibacterial properties, although the specific biological activity of this compound would require further empirical studies to elucidate its efficacy and mechanism of action. Overall, this compound represents a class of molecules with diverse applications in drug discovery and development.
Formula:C18H22N4O5S
InChI:InChI=1S/C18H22N4O5S/c1-12-5-7-13(8-6-12)19-15-10-9-14(22(24)25)11-16(15)28(26,27)21-17(23)20-18(2,3)4/h5-11,19H,1-4H3,(H2,20,21,23)
InChI key:InChIKey=SILRUCMXYIKULW-UHFFFAOYSA-N
SMILES:S(NC(NC(C)(C)C)=O)(=O)(=O)C1=C(NC2=CC=C(C)C=C2)C=CC(N(=O)=O)=C1
Synonyms:- N-[[(1,1-Dimethylethyl)amino]carbonyl]-2-[(4-methylphenyl)amino]-5-nitrobenzenesulfonamide
- BM 573
- Benzenesulfonamide, N-[[(1,1-dimethylethyl)amino]carbonyl]-2-[(4-methylphenyl)amino]-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
BM573
CAS:<p>BM573 is a dual thromboxane synthase inhibitor and thromboxane receptor antagonist.</p>Formula:C18H22N4O5SColor and Shape:SolidMolecular weight:406.46
