CAS 284487-65-6

Pentane-1,1,1,2,2,3,3,4,5,5,5-d11, 4-(methyl-d3)-

Description:

Pentane-1,1,1,2,2,3,3,4,5,5,5-d11, 4-(methyl-d3)- is a deuterated derivative of pentane, which is a straight-chain alkane with five carbon atoms. The presence of deuterium (d) indicates that certain hydrogen atoms in the molecule have been replaced with deuterium isotopes, which are heavier than regular hydrogen. This substitution can affect the physical properties of the compound, such as its boiling point and density, making it useful in various applications, including NMR spectroscopy and tracer studies in chemical research. The compound features a branched structure due to the methyl group substitution at the fourth carbon, which can influence its reactivity and interactions with other substances. As a deuterated compound, it is often employed in studies requiring isotopic labeling, providing insights into reaction mechanisms and molecular dynamics. Overall, this compound exemplifies the utility of isotopically labeled substances in advancing our understanding of chemical processes.

Formula: C₆D₁₄

InChI: InChI=1S/C6H14/c1-4-5-6(2)3/h6H,4-5H2,1-3H3/i1D3,2D3,3D3,4D2,5D2,6D

InChI key: InChIKey=AFABGHUZZDYHJO-YSWKHMAKSA-N

SMILES: C(C(C([2H])([2H])[2H])(C([2H])([2H])[2H])[2H])(C(C([2H])([2H])[2H])([2H])[2H])([2H])[2H]

Synonyms:

• Pentane-1,1,1,2,2,3,3,4,5,5,5-d11, 4-(methyl-d3)-

2-Methylpentane-d14

CAS: 284487-65-6

Formula: CD₃CD₂CD₂CD(CD₃)₂

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 100.19742

Ref: 3U-D5435

2-Methylpentane-d14

Controlled Product

CAS: 284487-65-6

Applications 2-Methylpentane-d14 (CAS# 284487-65-6) is a useful isotopically labeled research compound.

Formula: C₆D₁₄

Color and Shape: Neat

Molecular weight: 100.26

Ref: TR-M226381