CAS 284492-06-4

3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-3-(3-methylphenyl)propanoic acid

Description:

3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-3-(3-methylphenyl)propanoic acid, commonly referred to as Fmoc-3-(3-methylphenyl)alanine, is a chemical compound characterized by its structure, which includes a fluorenylmethoxycarbonyl (Fmoc) protecting group attached to an amino acid derivative. This compound features a propanoic acid backbone with an amino group and a side chain consisting of a 3-methylphenyl group. The Fmoc group is widely used in peptide synthesis as a protective group for amino acids, allowing for selective reactions without interfering with the amino functionality. The presence of the aromatic 3-methylphenyl group contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with other molecules. Additionally, the compound is typically utilized in the field of organic synthesis and biochemistry, particularly in the synthesis of peptides and proteins. Its CAS number, 284492-06-4, serves as a unique identifier for regulatory and research purposes, facilitating the tracking and study of this specific chemical entity.

Formula: C₂₅H₂₃NO₄

InChI: InChI=1/C25H23NO4/c1-16-7-6-8-17(13-16)23(14-24(27)28)26-25(29)30-15-22-20-11-4-2-9-18(20)19-10-3-5-12-21(19)22/h2-13,22-23H,14-15H2,1H3,(H,26,29)(H,27,28)

SMILES: Cc1cccc(c1)C(CC(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12

Benzenepropanoic acid, b-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-3-methyl-

CAS: 284492-06-4

Formula: C₂₅H₂₃NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 401.4544

Ref: IN-DA00BEGF

3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(m-tolyl)propanoic acid

CAS: 284492-06-4

3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(m-tolyl)propanoic acid

Purity: 98%

Molecular weight: 401.45g/mol

Ref: 54-OR75948

Fmoc-3-amino-3-(3-methylphenyl)-propionic acid

CAS: 284492-06-4

Formula: C₂₅H₂₃NO₄

Purity: 98%

Molecular weight: 401.462

Ref: 10-F300127