CAS 284492-07-5

3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-3-(3-fluorophenyl)propanoic acid

Description:

3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-3-(3-fluorophenyl)propanoic acid, with CAS number 284492-07-5, is a synthetic organic compound characterized by its complex structure that includes a fluorophenyl group and a fluorenylmethoxycarbonyl (Fmoc) protecting group. This compound is typically used in peptide synthesis and other organic synthesis applications due to its ability to protect amino groups during chemical reactions. The presence of the fluorine atom in the phenyl ring can enhance the compound's biological activity and lipophilicity, making it of interest in medicinal chemistry. The Fmoc group is particularly valuable for its stability under basic conditions and ease of removal under acidic conditions, facilitating the stepwise synthesis of peptides. Additionally, the propanoic acid moiety contributes to the compound's solubility and reactivity. Overall, this compound exemplifies the intricate design often required in the development of pharmaceutical agents and research chemicals.

Formula: C₂₄H₂₀FNO₄

InChI: InChI=1/C24H20FNO4/c25-16-7-5-6-15(12-16)22(13-23(27)28)26-24(29)30-14-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-12,21-22H,13-14H2,(H,26,29)(H,27,28)

SMILES: c1ccc2c(c1)c1ccccc1C2COC(=NC(CC(=O)O)c1cccc(c1)F)O

Fmoc-3-Amino-3-(3-fluorophenyl)propionic acid

CAS: 284492-07-5

Formula: C₂₄H₂₀FNO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 405.4183

Ref: IN-DA01DTM3

3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-fluorophenyl)propanoic acid

CAS: 284492-07-5

3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-fluorophenyl)propanoic acid

Purity: 98%

Molecular weight: 405.42g/mol

Ref: 54-PC100087

3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-fluorophenyl)propanoic acid

CAS: 284492-07-5

Purity: 98%

Molecular weight: 405.4249878

Ref: 10-F624194