CAS 284492-24-6

β-[[(1,1-Dimethylethoxy)carbonyl]amino]-3-furanpropanoic acid

Description:

β-[[(1,1-Dimethylethoxy)carbonyl]amino]-3-furanpropanoic acid, with the CAS number 284492-24-6, is a chemical compound characterized by its unique structure that includes a furan ring and an amino acid derivative. This compound features a β-amino acid framework, which is notable for its potential applications in pharmaceuticals and biochemistry. The presence of the 1,1-dimethylethoxycarbonyl group enhances its stability and solubility, making it suitable for various synthetic processes. The furan moiety contributes to its reactivity and can participate in various chemical reactions, including electrophilic substitutions. Additionally, the compound's acidic properties are attributed to the carboxylic acid functional group, which can influence its behavior in biological systems. Overall, this compound exemplifies the intersection of organic chemistry and medicinal chemistry, with implications for drug design and development. Its specific characteristics, such as solubility, reactivity, and stability, are essential for understanding its potential applications in research and industry.

Formula: C₁₂H₁₇NO₅

InChI: InChI=1S/C12H17NO5/c1-12(2,3)18-11(16)13-9(6-10(14)15)8-4-5-17-7-8/h4-5,7,9H,6H2,1-3H3,(H,13,16)(H,14,15)

InChI key: InChIKey=JMRUMNAUPGNUDB-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)(CC(O)=O)C=1C=COC1

3- tert -Butoxycarbonylamino-3-furan-3-yl-propionic acid

CAS: 284492-24-6

Formula: C₁₂H₁₇NO₅

Molecular weight: 255.27

Ref: 10-F031861