
CAS 28452-66-6
:Butanedioic acid, 2-methylene-, 1,4-dibutyl ester, homopolymer
Description:
Butanedioic acid, 2-methylene-, 1,4-dibutyl ester, homopolymer, commonly known as a type of polybutylene succinate, is a synthetic polymer characterized by its biodegradable properties. This polymer is derived from the polymerization of butanedioic acid and butanol, resulting in a structure that exhibits flexibility and durability. It typically appears as a white to off-white solid and is soluble in organic solvents while being insoluble in water. The polymer's thermal stability allows it to withstand moderate temperatures, making it suitable for various applications, including packaging materials and agricultural films. Its biodegradability is a significant advantage, as it can break down in natural environments, reducing plastic waste. Additionally, this polymer exhibits good mechanical properties, such as tensile strength and elongation, which can be tailored through copolymerization or blending with other materials. Overall, butanedioic acid, 2-methylene-, 1,4-dibutyl ester, homopolymer is valued for its environmental benefits and versatility in industrial applications.
Formula:(C13H22O4)x
InChI:InChI=1S/C13H22O4/c1-4-6-8-16-12(14)10-11(3)13(15)17-9-7-5-2/h3-10H2,1-2H3
InChI key:InChIKey=OGVXYCDTRMDYOG-UHFFFAOYSA-N
SMILES:C(C(OCCCC)=O)(CC(OCCCC)=O)=C
Synonyms:- Succinic acid, methylene-, dibutyl ester, polymers
- Butanedioic acid, 2-methylene-, 1,4-dibutyl ester, homopolymer
- Poly(dibutyl itaconate)
- Butanedioic acid, methylene-, dibutyl ester, homopolymer
- Dibutyl itaconate polymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Butanedioic acid, 2-methylene-, 1,4-dibutyl ester, homopolymer
CAS:Formula:C13H22O4Molecular weight:242.3114
