CAS 2846-29-9
:Cholesterol 7α-hydroperoxide
Description:
Cholesterol 7α-hydroperoxide is an oxidized derivative of cholesterol, characterized by the presence of a hydroperoxide functional group at the 7α position of the steroid structure. This compound is typically formed through the oxidative processes involving cholesterol, often in biological systems where reactive oxygen species are present. Cholesterol 7α-hydroperoxide is known to play a role in various biochemical pathways, including those related to cell signaling and the regulation of lipid metabolism. Its presence can indicate oxidative stress and has been implicated in the pathogenesis of several diseases, including atherosclerosis and neurodegenerative disorders. The compound is relatively unstable and can further decompose into other products, which may have different biological activities. As a hydroperoxide, it exhibits properties typical of peroxides, such as being a potential source of free radicals, which can lead to cellular damage if not properly regulated. Understanding its characteristics and behavior is crucial for studying its implications in health and disease.
Formula:C27H46O3
InChI:InChI=1/C27H46O3/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(28)15-19(26)16-24(25)30-29/h16-18,20-25,28-29H,6-15H2,1-5H3/t18-,20+,21-,22+,23+,24-,25+,26+,27-/m1/s1
InChI key:InChIKey=KJIGLXGIVLBXCF-RVOWOUOISA-N
SMILES:O(O)[C@H]1[C@]2([C@]3([C@@](C)([C@@]([C@@H](CCCC(C)C)C)(CC3)[H])CC[C@@]2([C@]4(C)C(=C1)C[C@@H](O)CC4)[H])[H])[H]
Synonyms:- Cholest-5-en-3β-ol, 7α-hydroperoxy-
- Hydroperoxide, 3β-hydroxycholest-5-en-7α-yl
- 7-α-hydroperoxycholesterol
- cholesterol 7-hydroperoxide
- (3β,7α)-7-Hydroperoxycholest-5-en-3-ol
- Cholest-5-en-3-ol, 7-hydroperoxy-, (3β,7α)-
- Cholesterol 7α-hydroperoxide
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
