CAS 2846-77-7

2-[(2-amino-6-chloropyrimidin-4-yl)amino]ethanol

Description:

2-[(2-amino-6-chloropyrimidin-4-yl)amino]ethanol, with the CAS number 2846-77-7, is a chemical compound characterized by its pyrimidine ring structure, which includes an amino group and a chlorine substituent. This compound features a hydroxyl group (-OH) attached to an ethylamine moiety, contributing to its potential as a polar, water-soluble substance. The presence of the amino groups suggests that it can participate in hydrogen bonding, enhancing its solubility in aqueous environments. The chlorine atom introduces a halogen, which can influence the compound's reactivity and biological activity. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be utilized in research related to nucleic acid interactions or as a building block in drug design. Overall, its unique structure and functional groups make it a compound of interest in various chemical and biological applications.

Formula: C₆H₉ClN₄O

InChI: InChI=1/C6H9ClN4O/c7-4-3-5(9-1-2-12)11-6(8)10-4/h3,12H,1-2H2,(H3,8,9,10,11)

SMILES: C(CO)N=c1cc(Cl)[nH]c(=N)[nH]1

Synonyms:

• Ethanol, 2-[(2-Amino-6-Chloro-4-Pyrimidinyl)Amino]-

2-[(2-Amino-6-chloropyrimidin-4-yl)amino]ethanol

CAS: 2846-77-7

Formula: C₆H₉ClN₄O

Color and Shape: Solid

Molecular weight: 188.6149

Ref: IN-DA002VCX

2-[(2-Amino-6-chloropyrimidin-4-yl)amino]ethanol

CAS: 2846-77-7

2-[(2-Amino-6-chloropyrimidin-4-yl)amino]ethanol

Purity: ≥95%

Color and Shape: Brown Solid

Molecular weight: 188.61g/mol

Ref: 54-OR111048

2-[(2-Amino-6-chloro-4-pyrimidinyl)amino]ethanol

CAS: 2846-77-7

Purity: 95.0%

Color and Shape: Solid, Yellow powder

Molecular weight: 188.6199951171875

Ref: 10-F075086