CAS 28460-55-1

3,3-dimethyl-3,4-dihydroisoquinoline

Description:

3,3-Dimethyl-3,4-dihydroisoquinoline is a bicyclic organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. This compound features two methyl groups attached to the carbon atom at the 3-position of the dihydroisoquinoline framework, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the dihydro group indicates that it has a saturated bond, which can influence its reactivity and stability. 3,3-Dimethyl-3,4-dihydroisoquinoline may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with various biological targets, which can be explored in pharmacological studies. Additionally, the compound's solubility and volatility can vary based on the presence of functional groups and the overall molecular weight, affecting its applications in synthesis and research. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₁H₁₃N

InChI: InChI=1/C11H13N/c1-11(2)7-9-5-3-4-6-10(9)8-12-11/h3-6,8H,7H2,1-2H3

SMILES: CC1(C)Cc2ccccc2C=N1

Synonyms:

• Isoquinoline, 3,4-Dihydro-3,3-Dimethyl-

3,3-Dimethyl-3,4-dihydroisoquinoline

CAS: 28460-55-1

Formula: C₁₁H₁₃N

Color and Shape: Liquid

Molecular weight: 159.2276

Ref: IN-DA002VDO

3,4-Dihydro-3,3-dimethylisoquinoline

Controlled Product

CAS: 28460-55-1

Applications 3,4-Dihydro-3,3-dimethylisoquinoline can be used as reagent/reactant in synthetic preparation and reactivity of hydroisoquinoline-derived oxaziridines.
References Kammoun, M., et al.: Synthetic Commun., 41, 1520-1528 (2011)

Formula: C₁₁H₁₃N

Color and Shape: Neat

Molecular weight: 159.23

Ref: TR-D450720