CAS 284664-87-5

Lysine-3,3,4,4,5,5,6,6-d8, dihydrochloride

Description:

Lysine-3,3,4,4,5,5,6,6-d8, dihydrochloride is a deuterated form of the amino acid lysine, specifically labeled at positions 3, 4, 5, and 6 with deuterium, which is a stable isotope of hydrogen. This compound is typically used in research applications, particularly in studies involving protein structure and dynamics, as the deuterium labeling can enhance NMR spectroscopy and mass spectrometry analysis. The dihydrochloride form indicates that the compound is a salt, where two hydrochloric acid molecules are associated with the lysine molecule, enhancing its solubility in aqueous solutions. Lysine itself is a basic amino acid, characterized by its positively charged side chain at physiological pH, which plays a crucial role in protein synthesis and various metabolic processes. The presence of deuterium allows for the tracking of molecular interactions and dynamics in biological systems, making it a valuable tool in biochemical research.

Formula: C₆H₆D₈N₂O₂·2ClH

InChI: InChI=1S/C6H14N2O2.2ClH/c7-4-2-1-3-5(8)6(9)10;;/h5H,1-4,7-8H2,(H,9,10);2*1H/i1D2,2D2,3D2,4D2;;

InChI key: InChIKey=JBBURJFZIMRPCZ-VHGLFXLXSA-N

SMILES: C(C(C(C(C(N)([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])(C(O)=O)N.Cl

Synonyms:

• (3,3,4,4,5,5,6,6-2H8)lysine dihydrochloride
• DL-Lysine-3,3,4,4,5,5,6,6-d8 dihydrochloride
• Lysine-3,3,4,4,5,5,6,6-d₈, dihydrochloride
• Lysine-3,3,4,4,5,5,6,6-d8, dihydrochloride

DL-Lysine-3,3,4,4,5,5,6,6-d8 2HCl

CAS: 284664-87-5

Formula: H₂N(CD₂)₄CH(NH₂)COOHHCl

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 190.13242

Ref: 3U-D2715

DL-Lysine-3,3,4,4,5,5,6,6-d8 2HCl

Controlled Product

CAS: 284664-87-5

Applications DL-Lysine-3,3,4,4,5,5,6,6-d8 2HCl (CAS# 284664-87-5) is a useful isotopically labeled research compound.

Formula: C₆H₈D₈Cl₂N₂O₂

Color and Shape: Neat

Molecular weight: 227.15

Ref: TR-D422732