CAS 284682-02-6
:2-chloro-6-(phenylsulfanyl)pyrimidin-4(3H)-one
Description:
2-Chloro-6-(phenylsulfanyl)pyrimidin-4(3H)-one is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at the 2-position and a phenylsulfanyl group at the 6-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound may exhibit biological activity due to its structural features, which can influence interactions with biological targets. The phenylsulfanyl moiety can enhance lipophilicity and may participate in various chemical reactions, including nucleophilic substitutions. The compound's properties, such as solubility, stability, and reactivity, can be influenced by the substituents on the pyrimidine ring. As with many heterocycles, it may serve as a scaffold for the development of pharmaceuticals or agrochemicals. Safety and handling considerations should be taken into account, as with any chemical substance, particularly those with halogen and sulfur functionalities.
Formula:C10H7ClN2OS
InChI:InChI=1/C10H7ClN2OS/c11-10-12-8(14)6-9(13-10)15-7-4-2-1-3-5-7/h1-6H,(H,12,13,14)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
