CAS 284686-20-0
:N-[5-Bromo-2-(cyclopropylamino)-4-methyl-3-pyridinyl]-2-chloro-3-pyridinecarboxamide
Description:
N-[5-Bromo-2-(cyclopropylamino)-4-methyl-3-pyridinyl]-2-chloro-3-pyridinecarboxamide, with CAS number 284686-20-0, is a chemical compound characterized by its complex structure, which includes multiple functional groups and heterocyclic rings. This compound features a pyridine backbone, which is a six-membered aromatic ring containing nitrogen, contributing to its potential biological activity. The presence of bromine and chlorine atoms indicates that it may exhibit unique reactivity and properties, such as increased lipophilicity or altered electronic characteristics. The cyclopropylamino group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the methyl group on the pyridine ring can influence the compound's steric and electronic properties, potentially affecting its pharmacokinetics and pharmacodynamics. Overall, this compound's structural features suggest it may have applications in drug development, particularly in targeting specific biological pathways or receptors. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C15H14BrClN4O
InChI:InChI=1S/C15H14BrClN4O/c1-8-11(16)7-19-14(20-9-4-5-9)12(8)21-15(22)10-3-2-6-18-13(10)17/h2-3,6-7,9H,4-5H2,1H3,(H,19,20)(H,21,22)
InChI key:InChIKey=GMTLDWLAZXKJQE-UHFFFAOYSA-N
SMILES:N(C(=O)C1=C(Cl)N=CC=C1)C2=C(NC3CC3)N=CC(Br)=C2C
Synonyms:- 3-Pyridinecarboxamide, N-[5-bromo-2-(cyclopropylamino)-4-methyl-3-pyridinyl]-2-chloro-
- N-[5-Bromo-2-(cyclopropylamino)-4-methyl-3-pyridinyl]-2-chloro-3-pyridinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.