CymitQuimica logo

CAS 2848-94-4

:

N-(2-Benzoyl-4-chlorophenyl)-2-bromo-N-methylacetamide

Description:
N-(2-Benzoyl-4-chlorophenyl)-2-bromo-N-methylacetamide, with the CAS number 2848-94-4, is a chemical compound that belongs to the class of acetamides. It features a complex structure characterized by the presence of a benzoyl group, a chlorophenyl moiety, and a bromo substituent, which contribute to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent characteristics. Its molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, particularly due to the presence of functional groups that can participate in various chemical reactions. The chlorophenyl and bromo substituents may also impart specific reactivity or biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as compounds with halogenated groups can pose environmental and health risks. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various chemical applications.
Formula:C16H13BrClNO2
InChI:InChI=1S/C16H13BrClNO2/c1-19(15(20)10-17)14-8-7-12(18)9-13(14)16(21)11-5-3-2-4-6-11/h2-9H,10H2,1H3
InChI key:InChIKey=ATRGENZZRLPDFV-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(N(C(CBr)=O)C)C=CC(Cl)=C1)C2=CC=CC=C2
Synonyms:
  • Acetamide, N-(2-benzoyl-4-chlorophenyl)-2-bromo-N-methyl-
  • N-(2-Benzoyl-4-chlorophenyl)-2-bromo-N-methylacetamide
  • Acetanilide, 2′-benzoyl-2-bromo-4′-chloro-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.