CymitQuimica logo

CAS 2849-92-5

:

1H-Benzimidazole-2-carboxylic acid, 1-methyl-, methyl ester

Description:
1H-Benzimidazole-2-carboxylic acid, 1-methyl-, methyl ester, commonly referred to as a benzimidazole derivative, is a chemical compound characterized by its benzimidazole core structure, which consists of a fused benzene and imidazole ring. This compound features a carboxylic acid functional group that is esterified with a methyl group, enhancing its solubility and reactivity. It typically exhibits properties such as moderate polarity, making it soluble in organic solvents while being less soluble in water. The presence of the methyl group at the 1-position of the benzimidazole ring can influence its biological activity, potentially enhancing its pharmacological properties. This compound is of interest in various fields, including medicinal chemistry, due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Its CAS number, 2849-92-5, allows for easy identification and retrieval of information in chemical databases. Overall, this compound exemplifies the diverse chemistry of benzimidazole derivatives and their utility in various applications.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c1-12-8-6-4-3-5-7(8)11-9(12)10(13)14-2/h3-6H,1-2H3
InChI key:YLGMNPUAHUGTKY-UHFFFAOYSA-N
SMILES:CN1C2=CC=CC=C2N=C1C(=O)OC
Synonyms:
  • 1H-Benzimidazole-2-carboxylic acid, 1-methyl-, methyl ester
  • 1H-Benzimidazole-2-carboxylicacid,1-methyl-,methylester(9CI)
  • 1-Methyl-1H-benzoimidazole-2-carboxylic acid methyl ester
  • methyl 1-methyl-2-benzimidazolecarboxylate
Found 2 products.