CAS 28491-02-3

3-(4-Chlorophenoxy)pyrrolidine

Description:

3-(4-Chlorophenoxy)pyrrolidine is an organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of a 4-chlorophenoxy group indicates that a chlorinated phenyl ether is attached to the pyrrolidine, influencing its chemical properties and reactivity. This compound typically exhibits moderate polarity due to the presence of both the aromatic and aliphatic components, which can affect its solubility in various solvents. It may participate in hydrogen bonding due to the nitrogen atom in the pyrrolidine ring, enhancing its interactions with other molecules. The chlorophenyl moiety can also impart specific electronic effects, potentially affecting the compound's biological activity. 3-(4-Chlorophenoxy)pyrrolidine may be of interest in medicinal chemistry and pharmacology, as similar compounds have been explored for their potential therapeutic applications. However, detailed studies on its specific biological properties and mechanisms of action would be necessary to fully understand its utility in these fields.

Formula: C₁₀H₁₂ClNO

InChI: InChI=1S/C10H12ClNO/c11-8-1-3-9(4-2-8)13-10-5-6-12-7-10/h1-4,10,12H,5-7H2

InChI key: InChIKey=GTDFBKVKKRBGIF-UHFFFAOYSA-N

SMILES: O(C1=CC=C(Cl)C=C1)C2CCNC2

Synonyms:

• Pyrrolidine, 3-(4-chlorophenoxy)-
• Pyrrolidine, 3-(p-chlorophenoxy)-
• 3-(4-Chlorophenoxy)pyrrolidine

3-(4-Chlorophenoxy)pyrrolidine

CAS: 28491-02-3

Versatile small molecule scaffold

Formula: C₁₀H₁₂ClNO

Purity: Min. 95%

Molecular weight: 197.66 g/mol

Ref: 3D-DBA49102