CAS 285-59-6: 3-Azabicyclo[3.1.0]hexane

Description: 3-Azabicyclo[3.1.0]hexane, with the CAS number 285-59-6, is a bicyclic organic compound characterized by a nitrogen atom incorporated into a six-membered ring structure. This compound features a unique bicyclic framework consisting of three carbon atoms and one nitrogen atom, resulting in a distinctive three-dimensional shape. It is a colorless to pale yellow liquid at room temperature and is known for its relatively high stability compared to other nitrogen-containing heterocycles. The presence of the nitrogen atom contributes to its basicity and potential reactivity, making it of interest in various chemical syntheses and applications, particularly in the fields of medicinal chemistry and organic synthesis. Its molecular structure allows for potential interactions with biological systems, which can be explored for pharmacological properties. Additionally, 3-Azabicyclo[3.1.0]hexane can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, further enhancing its utility in synthetic organic chemistry.

Formula: C₅H₉N

InChI: InChI=1S/C5H9N/c1-4-2-6-3-5(1)4/h4-6H,1-3H2

InChI key: InChIKey=HGWUUOXXAIISDB-UHFFFAOYSA-N

SMILES: N1CC2CC2C1

Synonyms:

• 3-Azabicyclo[3.1.0]hexane

3-azabicyclo[3.1.0]hexane

CAS: 285-59-6

• Formula: C₅H₉N
• Purity: 97%
• Color and Shape: Solid
• Molecular weight: 83.1317

3-Aza-bicyclo[3.1.0]hexane

CAS: 285-59-6

• Purity: 95.0%
• Color and Shape: Solid
• Molecular weight: 83.13400268554688