CAS 285-86-9
:bicyclo[2.1.1]hexane
Description:
Bicyclo[2.1.1]hexane is a bicyclic organic compound characterized by its unique structure, which consists of two fused cyclopropane rings. This compound has a molecular formula of C6H10 and features a distinctive three-dimensional arrangement that contributes to its chemical properties. Bicyclo[2.1.1]hexane is known for its strain due to the angle strain in the cyclopropane rings, which can influence its reactivity and stability. It is a colorless liquid at room temperature and has a relatively low boiling point compared to other hydrocarbons. The compound is non-polar and insoluble in water, but it is soluble in organic solvents. Bicyclo[2.1.1]hexane can undergo various chemical reactions, including hydrogenation and substitution reactions, making it of interest in synthetic organic chemistry. Its unique structure also makes it a valuable model for studying strain and reactivity in cyclic compounds. Overall, bicyclo[2.1.1]hexane serves as an important compound in the field of organic chemistry, particularly in the study of molecular strain and reactivity.
Formula:C6H10
InChI:InChI=1/C6H10/c1-2-6-3-5(1)4-6/h5-6H,1-4H2
SMILES:C1CC2CC1C2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
