CymitQuimica logo

CAS 28508-48-7

:

Hydroxymethoxybenzoicacidsodiumsalt; 98%

Description:
Hydroxymethoxybenzoic acid sodium salt, with the CAS number 28508-48-7, is a chemical compound that belongs to the class of benzoic acid derivatives. It typically appears as a white to off-white powder and is soluble in water, which makes it useful in various applications, including pharmaceuticals and biochemistry. The compound features hydroxyl (-OH) and methoxy (-OCH3) functional groups, contributing to its reactivity and potential biological activity. Its sodium salt form enhances its solubility and stability in aqueous environments. Hydroxymethoxybenzoic acid sodium salt is often studied for its antioxidant properties and potential therapeutic effects, particularly in the context of anti-inflammatory and anticancer research. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines, as well as any potential hazards associated with its use. Overall, this compound exemplifies the diverse functionalities of organic acids and their derivatives in scientific research and industrial applications.
Formula:C8H7NaO4
InChI:InChI=1/C8H8O4.Na/c1-12-7-4-5(8(10)11)2-3-6(7)9;/h2-4,9H,1H3,(H,10,11);/q;+1/p-1
InChI key:ZFRVFUWCVYLUIH-UHFFFAOYSA-M
SMILES:COc1cc(ccc1O)C(=O)O.[Na]
Synonyms:
  • 4-Hydroxy-3-methoxybenzoic acid sodium salt
  • Sodium 4-Hydroxy-3-Methoxybenzoate
Found 4 products.