CAS 2851-12-9

2-(piperidin-1-yl)-1H-benzimidazole

Description:

2-(Piperidin-1-yl)-1H-benzimidazole, with the CAS number 2851-12-9, is a chemical compound characterized by its unique structure that combines a benzimidazole moiety with a piperidine ring. This compound typically exhibits properties such as being a solid at room temperature, with moderate solubility in polar solvents like water and alcohols, while being less soluble in non-polar solvents. The presence of both the benzimidazole and piperidine groups contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly for its possible applications in pharmaceuticals. The compound may exhibit various functional properties, including potential interactions with biological targets, which can be explored in drug development. Additionally, it may possess basic characteristics due to the nitrogen atoms in its structure, influencing its reactivity and interactions in chemical reactions. Overall, 2-(piperidin-1-yl)-1H-benzimidazole is a versatile compound with significant implications in research and development within the field of chemistry and pharmacology.

Formula: C₁₂H₁₅N₃

InChI: InChI=1/C12H15N3/c1-4-8-15(9-5-1)12-13-10-6-2-3-7-11(10)14-12/h2-3,6-7H,1,4-5,8-9H2,(H,13,14)

SMILES: C1CCN(CC1)c1nc2ccccc2[nH]1

Synonyms:

• 1H-benzimidazole, 2-(1-piperidinyl)-