CAS 285138-82-1

2-Propenoic-2,3,3-d3 acid-d

Description:

2-Propenoic-2,3,3-d3 acid-d, also known as deuterated acrylic acid, is a deuterated form of acrylic acid, which is an unsaturated carboxylic acid. Its molecular formula is C3H3D3O2, indicating the presence of deuterium isotopes in place of some hydrogen atoms. This compound is characterized by its double bond between the first and second carbon atoms, which contributes to its reactivity and ability to undergo polymerization. The presence of the carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Deuterated compounds like this one are often used in NMR spectroscopy and other analytical techniques to study molecular structures and dynamics due to the distinct spectral signatures of deuterium. Additionally, 2-Propenoic-2,3,3-d3 acid-d can be utilized in research and industrial applications, particularly in the synthesis of polymers and other organic compounds. Its unique isotopic labeling makes it valuable in tracing and understanding reaction mechanisms.

Formula: C₃D₄O₂

InChI: InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5)/i1D2,2D/hD

InChI key: InChIKey=NIXOWILDQLNWCW-JMLDNBOGSA-N

SMILES: C(C(=C([2H])[2H])[2H])(O[2H])=O

Synonyms:

• 2-Propenoic-2,3,3-d3 acid-d
• Deuterio 2,3,3-trideuterioprop-2-enoate

Acrylic Acid-d4

CAS: 285138-82-1

Formula: CD₂CDCOOD

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 76.04624

Ref: 3U-D2724

Acrylic Acid-d4

Controlled Product

CAS: 285138-82-1

Applications Acrylic Acid-d4 (CAS# 285138-82-1) is a useful isotopically labeled research compound.

Formula: C₃D₄O₂

Color and Shape: Neat

Molecular weight: 76.09

Ref: TR-A191363

Acrylic acid-d4

CAS: 285138-82-1

Acrylic acid-d4 is a medicinal compound that has been studied for its potential as an inhibitor of cancer cells. It has been shown to induce apoptosis (cell death) in human leukemia cells by inhibiting a specific kinase. This inhibition disrupts the cell cycle and prevents the growth of tumor cells. Acrylic acid-d4 is also being investigated as a potential treatment for other types of cancer, including breast and lung cancer. In addition to its anti-cancer properties, this compound has also been studied for its ability to inhibit certain proteins involved in inflammation. Its unique isotopic composition makes it a valuable tool for researchers studying the mechanisms of cancer and inflammation at the molecular level.

Formula: C₃H₄O₂

Purity: Min. 95%

Molecular weight: 76.09 g/mol

Ref: 3D-KLA13882

ACRYLIC ACID-D4

CAS: 285138-82-1

Formula: C₃D₄O₂

Color and Shape: Liquid

Molecular weight: 76.0873

Ref: IN-DA00BEN0