CAS 285158-15-8
:N-[4-Bromo-2-(2-chlorobenzoyl)phenyl]-2-chloroacetamide
Description:
N-[4-Bromo-2-(2-chlorobenzoyl)phenyl]-2-chloroacetamide, with the CAS number 285158-15-8, is a chemical compound characterized by its complex structure, which includes a bromine atom, two chlorine atoms, and an acetamide functional group. This compound features a phenyl ring substituted with a bromo group and a chlorobenzoyl moiety, indicating potential reactivity and biological activity. The presence of halogens (bromine and chlorine) often enhances the lipophilicity and biological interactions of the molecule, making it of interest in medicinal chemistry and drug development. The acetamide group contributes to its solubility and potential interactions with biological targets. As with many halogenated compounds, it may exhibit unique properties such as altered melting and boiling points, stability under various conditions, and specific reactivity patterns. Safety and handling precautions are essential due to the presence of halogens, which can pose environmental and health risks. Overall, this compound's structural features suggest potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and effects.
Formula:C15H10BrCl2NO2
InChI:InChI=1S/C15H10BrCl2NO2/c16-9-5-6-13(19-14(20)8-17)11(7-9)15(21)10-3-1-2-4-12(10)18/h1-7H,8H2,(H,19,20)
InChI key:InChIKey=BXAWZJZMYSSHAK-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(NC(CCl)=O)C=CC(Br)=C1)C2=C(Cl)C=CC=C2
Synonyms:- Acetamide, N-[4-bromo-2-(2-chlorobenzoyl)phenyl]-2-chloro-
- N-[4-Bromo-2-(2-chlorobenzoyl)phenyl]-2-chloroacetamide
- N-[4-Bromo-2-(2-chlorobenzoyl)phenyl]-2-chloroacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-[4-bromo-2-(2-chlorobenzoyl)phenyl]-2-chloroacetamide
CAS:Formula:C15H10BrCl2NO2Molecular weight:387.0554
