CAS 2852-68-8
:bis(3-methylphenyl)methanone
Description:
Bis(3-methylphenyl)methanone, also known as benzyl 3-methylphenyl ketone, is an organic compound characterized by its structure, which features a central carbon atom bonded to two 3-methylphenyl groups and a carbonyl group (C=O). This compound is typically a white to light yellow solid at room temperature and is known for its aromatic properties due to the presence of the phenyl rings. It is relatively stable under standard conditions but may undergo reactions typical of ketones, such as nucleophilic addition. Bis(3-methylphenyl)methanone is often used in organic synthesis and may serve as an intermediate in the production of various chemical compounds. Its solubility is generally higher in organic solvents than in water, reflecting its hydrophobic nature. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Proper safety measures, including the use of personal protective equipment, are recommended when working with this substance.
Formula:C15H14O
InChI:InChI=1/C15H14O/c1-11-5-3-7-13(9-11)15(16)14-8-4-6-12(2)10-14/h3-10H,1-2H3
SMILES:Cc1cccc(c1)C(=O)c1cccc(C)c1
Synonyms:- Benzophenone, 3,3'-dimethyl-
- Methanone, bis(3-methylphenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methanone, bis(3-methylphenyl)-
CAS:Formula:C15H14OPurity:95%Color and Shape:SolidMolecular weight:210.2711Bis(3-methylphenyl)methanone
CAS:The molecule is a benzene with two methyl groups at the 3 and 5 positions. The dipole moment of this molecule is 0.6 D, which means that it can be oriented in two different ways. Molecular conformations are analysed by calculating the energy of the molecule when it is rotated around its axis. This molecule has three possible conformations, with two of them being more stable than the other one.
Formula:C15H14OPurity:Min. 95%Molecular weight:210.27 g/mol
