CAS 28533-43-9

4-(formylamino)benzoic acid

Description:

4-(Formylamino)benzoic acid, also known as anthranilic acid, is an aromatic compound characterized by the presence of both an amino group and a formyl group attached to a benzoic acid structure. This compound typically appears as a white to off-white crystalline solid and is soluble in water, reflecting its polar functional groups. The presence of the carboxylic acid group contributes to its acidic properties, while the amino group can participate in hydrogen bonding, enhancing its solubility in polar solvents. It is often used in organic synthesis and as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. Additionally, 4-(formylamino)benzoic acid can exhibit biological activity, making it of interest in medicinal chemistry. Its reactivity is influenced by the electron-withdrawing nature of the carboxylic acid and the electron-donating nature of the amino group, allowing for various chemical transformations. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₇NO₃

InChI: InChI=1/C8H7NO3/c10-5-9-7-3-1-6(2-4-7)8(11)12/h1-5H,(H,9,10)(H,11,12)

SMILES: c1cc(ccc1C(=O)O)N=CO

Synonyms:

• Benzoic Acid, 4-(Formylamino)-

Benzoic acid, 4-(formylamino)-

CAS: 28533-43-9

Formula: C₈H₇NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 165.1461

Ref: IN-DA002VNO

4-Formamidobenzoic acid

CAS: 28533-43-9

4-Formamidobenzoic acid

Purity: 98%

Molecular weight: 165.15g/mol

Ref: 54-OR91242

4-Formamidobenzoic acid

CAS: 28533-43-9

Purity: 95%

Molecular weight: 165.147995

Ref: 10-F791489