CAS 28538-70-7
:N-Methyl-N-nitroso-1-hexanamine
Description:
N-Methyl-N-nitroso-1-hexanamine, with the CAS number 28538-70-7, is a chemical compound that belongs to the class of nitrosamines, which are known for their potential carcinogenic properties. This substance features a hexanamine backbone, where a methyl group and a nitroso group are attached to the nitrogen atom. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. N-Methyl-N-nitroso-1-hexanamine is soluble in organic solvents but has limited solubility in water. The compound is of interest in various fields, including organic chemistry and toxicology, due to its reactivity and the implications of nitrosamines in biological systems. Safety precautions are essential when handling this substance, as nitrosamines can pose health risks, including potential carcinogenic effects upon exposure. Proper storage and disposal methods should be followed to mitigate any environmental or health hazards associated with this compound.
Formula:C7H16N2O
InChI:InChI=1S/C7H16N2O/c1-3-4-5-6-7-9(2)8-10/h3-7H2,1-2H3
InChI key:InChIKey=IHGPEUQKUIKKIR-UHFFFAOYSA-N
SMILES:N(CCCCCC)(N=O)C
Synonyms:- Hexylamine, N-methyl-N-nitroso-
- Nitrosomethylhexylamine
- N-Methyl-N-nitroso-1-hexanamine
- N-Nitroso-N-methylhexylamine
- 1-Hexanamine, N-methyl-N-nitroso-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
