CAS 2854-09-3
:1-(2-Hydroxyethyl)-5-nitro-1H-pyrrole-2-carboxamide
Description:
1-(2-Hydroxyethyl)-5-nitro-1H-pyrrole-2-carboxamide, with the CAS number 2854-09-3, is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a nitro group (-NO2) at the 5-position and a carboxamide group (-C(=O)NH2) at the 2-position, along with a hydroxyethyl substituent at the 1-position. The presence of these functional groups contributes to its polar nature, enhancing its solubility in polar solvents. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities. Its nitro group may participate in redox reactions, while the hydroxyethyl group can influence its interaction with biological targets. Additionally, the carboxamide moiety can engage in hydrogen bonding, affecting the compound's stability and reactivity. Overall, this compound's unique structural features make it a subject of study for its potential applications in pharmaceuticals and other chemical research areas.
Formula:C7H9N3O4
InChI:InChI=1S/C7H9N3O4/c8-7(12)5-1-2-6(10(13)14)9(5)3-4-11/h1-2,11H,3-4H2,(H2,8,12)
InChI key:InChIKey=RFQOPUYDLCMQCE-UHFFFAOYSA-N
SMILES:C(CO)N1C(C(N)=O)=CC=C1N(=O)=O
Synonyms:- 15960RP
- 1H-Pyrrole-2-carboxamide, 1-(2-hydroxyethyl)-5-nitro-
- 1-(2-Hydroxyethyl)-2-carbamoyl-5-nitropyrrole
- 1-(2-Hydroxyethyl)-5-nitro-1H-pyrrole-2-carboxamide
- Pyrrole-2-carboxamide, 1-(2-hydroxyethyl)-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
