CAS 2854-32-2
:2-[1-(4-Chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]-1-(4-morpholinyl)ethanone
Description:
The chemical substance known as 2-[1-(4-Chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]-1-(4-morpholinyl)ethanone, with the CAS number 2854-32-2, is a complex organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a chlorobenzoyl group, a methoxy group, and a morpholinyl group, contributing to its diverse chemical properties and potential biological activities. The presence of the chlorobenzoyl moiety may enhance its lipophilicity, while the morpholinyl group can influence its pharmacological profile. The compound may exhibit various interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization typically involve standard organic reactions, and it may be evaluated for its efficacy in various applications, including as a potential therapeutic agent. Safety and handling precautions should be observed due to the presence of halogenated and nitrogen-containing groups, which may pose specific health risks.
Formula:C23H23ClN2O4
InChI:InChI=1S/C23H23ClN2O4/c1-15-19(14-22(27)25-9-11-30-12-10-25)20-13-18(29-2)7-8-21(20)26(15)23(28)16-3-5-17(24)6-4-16/h3-8,13H,9-12,14H2,1-2H3
InChI key:InChIKey=BJSDNVVWJYDOLK-UHFFFAOYSA-N
SMILES:C(=O)(N1C=2C(C(CC(=O)N3CCOCC3)=C1C)=CC(OC)=CC2)C4=CC=C(Cl)C=C4
Synonyms:- (4-chlorophenyl)[5-methoxy-2-methyl-3-(2-morpholin-4-yl-2-oxoethyl)-2H-indol-2-yl]methanone
- 1H-Indole, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-3-[2-(4-morpholinyl)-2-oxoethyl]-
- 2-(1-(4-Chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl)-1-morpholinoethanone
- 2-[1-(4-Chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]-1-(4-morpholinyl)ethanone
- 2-[1-(4-Chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]-1-(morpholin-4-yl)ethan-1-one
- 2-[1-(4-Chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-1-morpholin-4-ylethanone
- Bml 190
- Ethanone, 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]-1-(4-morpholinyl)-
- Indole, 1-(p-chlorobenzoyl)-5-methoxy-2-methyl-3-[(morpholinocarbonyl)methyl]-
- Lm-4131
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethanone, 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]-1-(4-morpholinyl)-
CAS:Formula:C23H23ClN2O4Purity:99%Color and Shape:SolidMolecular weight:426.89272-(1-(4-Chlorobenzoyl)-5-Methoxy-2-Methyl-1H-Indol-3-Yl)-1-Morpholinoethanone
CAS:2-(1-(4-Chlorobenzoyl)-5-Methoxy-2-Methyl-1H-Indol-3-Yl)-1-MorpholinoethanonePurity:99%Molecular weight:426.89g/molBML-190
CAS:BML-190 (Indomethacin morpholinylamide) 是一种 CB2 受体的配体,其对 CB2 受体 (Ki:435 nM) 和 CB1受体 (Ki> 2 μM)。Formula:C23H23ClN2O4Purity:97.70%Color and Shape:SolidMolecular weight:426.89BML-190
CAS:BML-190 is a quinoline compound that inhibits the growth of cancer cells. It has antimicrobial activity and can bind to the CB2 receptor on cells, preventing the binding of endogenous cannabinoids. BML-190 also blocks the production of certain growth factors and erythropoietin, which may inhibit tumor proliferation. BML-190 has been shown to have anti-inflammatory properties in animal models. This drug has been shown to have anticancer effects in rat liver microsomes and colorectal carcinoma cells in vitro. BML-190 is not active against cryptococcus neoformans, although it inhibits pluripotent stem cell growth in vitro.Formula:C23H23ClN2O4Purity:Min. 95%Molecular weight:426.89 g/mol



