CAS 28547-29-7
:2-Bromo-4-iodobenzoic acid
Description:
2-Bromo-4-iodobenzoic acid is an aromatic carboxylic acid characterized by the presence of both bromine and iodine substituents on the benzene ring. Specifically, the bromine atom is located at the second position and the iodine atom at the fourth position relative to the carboxylic acid group. This compound typically appears as a solid and is known for its moderate solubility in organic solvents, while being less soluble in water due to the hydrophobic nature of the halogen substituents. It exhibits properties typical of halogenated benzoic acids, including potential applications in organic synthesis and medicinal chemistry. The presence of both halogens can influence its reactivity, making it a useful intermediate in the synthesis of more complex molecules. Additionally, 2-Bromo-4-iodobenzoic acid may exhibit biological activity, which can be explored in various research contexts. Safety precautions should be taken when handling this compound, as it may pose health risks associated with halogenated organic compounds.
Formula:C7H4BrIO2
InChI:InChI=1S/C7H4BrIO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,(H,10,11)
InChI key:InChIKey=APGWJGNOWJHSLW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Br)C=C(I)C=C1
Synonyms:- 2-Bromo-4-iodo-benzoic acid
- Benzoic acid, 2-bromo-4-iodo-
- 2-Bromo-4-iodobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 2-bromo-4-iodo-
CAS:Formula:C7H4BrIO2Purity:96%Color and Shape:SolidMolecular weight:326.91392-Bromo-4-iodobenzoic acid
CAS:2-Bromo-4-iodobenzoic acidFormula:C7H4BrIO2Purity:98%Color and Shape: orange to brown powderMolecular weight:326.91g/mol2-Bromo-4-iodobenzoic acid
CAS:2-Bromo-4-iodobenzoic acid is a high quality, versatile building block that is used as an intermediate in the synthesis of many fine chemicals and speciality chemicals. It has been found to be useful in the preparation of various pharmaceuticals and agrochemicals, as well as research chemicals. This compound is also a useful scaffold for the synthesis of complex compounds with biological activity. 2-Bromo-4-iodobenzoic acid has been used as a reagent in organic synthesis, and can be used to generate new chemical reaction components for use in laboratory experiments.Formula:C7H4BrIO2Purity:Min. 95%Color and Shape:PowderMolecular weight:326.91 g/mol2-Bromo-4-iodobenzoic acid
CAS:Formula:C7H4BrIO2Purity:95%Color and Shape:SolidMolecular weight:326.915



