CAS 285552-82-1

2-(3,4-Dichlorophenyl)-2,3-dihydro-1,3-dioxo-1H-isoindole-5-carboxylic acid

Description:

2-(3,4-Dichlorophenyl)-2,3-dihydro-1,3-dioxo-1H-isoindole-5-carboxylic acid, with the CAS number 285552-82-1, is a chemical compound characterized by its complex structure, which includes an isoindole core and multiple functional groups. This substance features a dichlorophenyl moiety, contributing to its potential biological activity and chemical reactivity. The presence of the dioxo group indicates that it may participate in various chemical reactions, including nucleophilic attacks and redox processes. The carboxylic acid functional group suggests that it can engage in acid-base reactions and may exhibit solubility in polar solvents. This compound is of interest in medicinal chemistry and may have applications in drug development due to its structural features, which could influence its pharmacological properties. Additionally, the dichlorophenyl group may enhance lipophilicity, affecting its bioavailability and interaction with biological targets. Overall, this compound's unique characteristics make it a subject of interest for further research in various chemical and biological contexts.

Formula: C₁₅H₇Cl₂NO₄

InChI: InChI=1S/C15H7Cl2NO4/c16-11-4-2-8(6-12(11)17)18-13(19)9-3-1-7(15(21)22)5-10(9)14(18)20/h1-6H,(H,21,22)

InChI key: InChIKey=WQJRCVALNJFUHE-UHFFFAOYSA-N

SMILES: O=C1N(C(=O)C=2C1=CC(C(O)=O)=CC2)C3=CC(Cl)=C(Cl)C=C3

Synonyms:

• 2-(3,4-Dichlorophenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid
• 2-(3,4-Dichlorophenyl)-2,3-dihydro-1,3-dioxo-1H-isoindole-5-carboxylic acid
• 2-(3,4-Dichlorophenyl)-1,3-dioxoisoindole-5-carboxylic acid
• 1H-Isoindole-5-carboxylic acid, 2-(3,4-dichlorophenyl)-2,3-dihydro-1,3-dioxo-