CAS 28562-53-0
:4-Acetoxy-2-azetidinone
Description:
4-Acetoxy-2-azetidinone, with the CAS number 28562-53-0, is a chemical compound characterized by its azetidinone structure, which is a four-membered lactam. This compound features an acetoxy group, contributing to its reactivity and potential applications in organic synthesis. Typically, azetidinones exhibit properties such as being polar and capable of forming hydrogen bonds due to the presence of the carbonyl and nitrogen functionalities. The acetoxy group enhances its solubility in organic solvents and may influence its reactivity in various chemical reactions, including acylation and nucleophilic substitutions. 4-Acetoxy-2-azetidinone may be utilized in the synthesis of pharmaceuticals and agrochemicals, owing to its structural motifs that can mimic biologically active compounds. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, making it a subject of interest in synthetic organic chemistry. Overall, 4-Acetoxy-2-azetidinone represents a versatile building block in the development of more complex chemical entities.
Formula:C5H7NO3
InChI:InChI=1S/C5H7NO3/c1-3(7)9-5-2-4(8)6-5/h5H,2H2,1H3,(H,6,8)
InChI key:InChIKey=OEYMQQDJCUHKQS-UHFFFAOYSA-N
SMILES:O(C(C)=O)C1CC(=O)N1
Synonyms:- 2-Acetoxyazetidin-4-one
- 2-Azetidinone, 4-(acetyloxy)-
- 2-Azetidinone, 4-hydroxy-, acetate (ester)
- 2-Oxoazetidinium 4-acetate
- 4-(Acetyloxy)-2-azetidinone
- 4-Oxoazetidin-2-Yl Acetate
- 4-Acetoxy-2-azetidinone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Azetidinone, 4-(acetyloxy)-
CAS:Formula:C5H7NO3Purity:97%Color and Shape:SolidMolecular weight:129.11404-Oxoazetidin-2-yl acetate
CAS:Formula:C5H7NO3Purity:97%Color and Shape:Solid, CrystallineMolecular weight:129.1154-Acetoxy-2-azetidinone
CAS:4-Acetoxy-2-azetidinone is a model for the synthesis of β-amino acids. It can be allylated at the α position to produce an enolate, which is then reacted with a nitrogen nucleophile to form an α,β unsaturated carbonyl group. The carbonyl group can be hydrolyzed to produce a hydroxyl group or chlorinated to produce a chloride. 4-Acetoxy-2-azetidinone has been used in asymmetric synthesis as a chiral auxiliary.
Formula:C5H7NO3Purity:Min. 95%Molecular weight:129.11 g/molRef: 3D-FA30790
Discontinued product



