CAS 28562-58-5: 4-oxoazetidin-2-yl benzoate

Description:4-Oxoazetidin-2-yl benzoate, with the CAS number 28562-58-5, is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. The presence of a carbonyl group (oxo) at the 4-position of the azetidine ring contributes to its reactivity and potential applications in organic synthesis. The benzoate moiety indicates that the compound is an ester formed from benzoic acid, which can influence its solubility and stability. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential interactions with biological targets, and it may serve as a building block for more complex molecules. The compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Overall, 4-oxoazetidin-2-yl benzoate represents a unique structure that could be explored for various chemical and pharmaceutical applications.

Formula:C₁₀H₉NO₃

InChI:InChI=1/C10H9NO3/c12-8-6-9(11-8)14-10(13)7-4-2-1-3-5-7/h1-5,9H,6H2,(H,11,12)/t9-/m0/s1

Synonyms:
2-Azetidinone, 4-(Benzoyloxy)-
(2R)-4-oxoazetidin-2-yl benzoate
(2S)-4-oxoazetidin-2-yl benzoate
4-Oxoazetidin-2-yl benzoate

Found 5 products.

Product data	Purity	Price range	Estimated delivery
4-Benzoyloxy-2-azetidinone REF: 3B-B1391CAS: 28562-58-5	>98.0%(HPLC)(qNMR)	134.00 €	Mon 07 Apr 25
2-Azetidinone, 4-(benzoyloxy)- REF: IN-DA002VPMCAS: 28562-58-5	98%	41.00 €~550.00 €	Mon 14 Apr 25
4-Benzoyloxy-2-azetidinone REF: 54-OR936652CAS: 28562-58-5	95%	186.00 €~866.00 €	Mon 21 Apr 25
4-Benzoyloxy-2-azetidinone REF: 10-F636206CAS: 28562-58-5	98%	To inquire	Thu 24 Apr 25
4-Benzoyloxy-2-azetidinone REF: 3D-DBA56258CAS: 28562-58-5	Min. 95%	- - -	Discontinued product