
CAS 28565-98-2
:2-[(phenylacetyl)amino]benzoate
Description:
2-[(Phenylacetyl)amino]benzoate, also known by its CAS number 28565-98-2, is an organic compound that features both an amide and a carboxylate functional group. This compound is characterized by its aromatic structure, which includes a benzoate moiety and a phenylacetyl group. The presence of these functional groups contributes to its potential applications in pharmaceuticals and biochemistry, particularly as a building block in drug synthesis or as an intermediate in organic reactions. The compound is typically a white to off-white solid, and its solubility can vary depending on the solvent used, often being more soluble in polar organic solvents. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its reactivity and stability. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C15H12NO3
InChI:InChI=1/C15H13NO3/c17-14(10-11-6-2-1-3-7-11)16-13-9-5-4-8-12(13)15(18)19/h1-9H,10H2,(H,16,17)(H,18,19)/p-1
SMILES:c1ccc(cc1)CC(=Nc1ccccc1C(=O)O)[O-]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(2-Phenylacetamido)benzoic acid
CAS:2-(2-Phenylacetamido)benzoic acidPurity:≥95%Molecular weight:255.27g/mol2-(2-Phenylacetamido)benzoic acid
CAS:2-(2-Phenylacetamido)benzoic acid is an anthranilate derivative that is used as a fluorescent probe for the determination of radical scavenging activity. It has also been shown to have antibacterial properties against Gram-negative bacteria and flavus, including Aspergillus flavus. 2-(2-Phenylacetamido)benzoic acid is not active against Gram-positive bacteria such as Staphylococcus aureus and Streptococcus pyogenes. The inhibitory concentrations of 2-(2-phenylacetamido)benzoic acid are determined by the dilution method.
Formula:C15H13NO3Purity:Min. 95%Molecular weight:255.27 g/mol


