CAS 28566-14-5

6,7-Dihydro-5H-cyclopenta[b]pyridin-5-one

Description:

6,7-Dihydro-5H-cyclopenta[b]pyridin-5-one, with the CAS number 28566-14-5, is a bicyclic compound that features a fused cyclopentane and pyridine structure. This compound is characterized by its nitrogen-containing heterocyclic ring, which contributes to its potential biological activity. The presence of the carbonyl group (ketone) at the 5-position enhances its reactivity and may influence its interactions with biological targets. Typically, compounds of this nature exhibit moderate to high lipophilicity, which can affect their solubility and permeability in biological systems. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine ring, which is often associated with various pharmacological properties. Additionally, the compound may participate in various chemical reactions, such as nucleophilic additions or cycloadditions, making it of interest in synthetic organic chemistry. Overall, 6,7-Dihydro-5H-cyclopenta[b]pyridin-5-one represents a versatile scaffold for further chemical exploration and potential therapeutic applications.

Formula: C₈H₇NO

InChI: InChI=1/C8H7NO/c10-8-4-3-7-6(8)2-1-5-9-7/h1-2,5H,3-4H2

SMILES: c1cc2c(CCC2=O)nc1

Synonyms:

• 5H-Cyclopenta[b]pyridin-5-one, 6,7-dihydro-
• 5H,6H,7H-cyclopenta[b]pyridin-5-one
• 6,7-Dihydro-5H-cyclopenta[b]pyridin-5-one

5H-Cyclopenta[b]pyridin-5-one, 6,7-dihydro-

CAS: 28566-14-5

Formula: C₈H₇NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 133.1473

Ref: IN-DA002VQJ

6,7-Dihydro-5H-cyclopenta[b]pyridin-5-one

CAS: 28566-14-5

6,7-Dihydro-5H-cyclopenta[b]pyridin-5-one

Purity: 95%

Color and Shape: Off-White Crystals

Molecular weight: 133.15g/mol

Ref: 54-OR60178

6,7-Dihydro-5H-cyclopenta[b]pyridin-5-one

CAS: 28566-14-5

Formula: C₈H₇NO

Purity: 95%

Color and Shape: Solid, Yellow powder

Molecular weight: 133.15

Ref: 10-F069209